C59H40N2O8 — CID 170198873
5-[4-[9-[4-[1,3-dioxo-2-(4-prop-2-enoxyphenyl)isoindol-5-yl]oxyphenyl]fluoren-9-yl]phenoxy]-2-(4-prop-2-enoxyphenyl)isoindole-1,3-dione (PubChem CID 170198873) has the molecular formula C59H40N2O8 and a molecular weight of 904.97 g/mol. Its IUPAC name is 5-[4-[9-[4-[1,3-dioxo-2-(4-prop-2-enoxyphenyl)isoindol-5-yl]oxyphenyl]fluoren-9-yl]phenoxy]-2-(4-prop-2-enoxyphenyl)isoindole-1,3-dione.
| Compound Name | 5-[4-[9-[4-[1,3-dioxo-2-(4-prop-2-enoxyphenyl)isoindol-5-yl]oxyphenyl]fluoren-9-yl]phenoxy]-2-(4-prop-2-enoxyphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 170198873 |
| Molecular Formula | C59H40N2O8 |
| Molecular Weight | 904.97 g/mol |
| Exact Mass | 904.28 |
| IUPAC Name | 5-[4-[9-[4-[1,3-dioxo-2-(4-prop-2-enoxyphenyl)isoindol-5-yl]oxyphenyl]fluoren-9-yl]phenoxy]-2-(4-prop-2-enoxyphenyl)isoindole-1,3-dione |
| SMILES | C=CCOc1ccc(N2C(=O)c3ccc(Oc4ccc(C5(c6ccc(Oc7ccc8c(c7)C(=O)N(c7ccc(OCC=C)cc7)C8=O)cc6)c6ccccc6-c6ccccc65)cc4)cc3C2=O)cc1 |
| InChI | InChI=1S/C59H40N2O8/c1-3-33-66-41-25-17-39(18-26-41)60-55(62)49-31-29-45(35-51(49)57(60)64)68-43-21-13-37(14-22-43)59(53-11-7-5-9-47(53)48-10-6-8-12-54(48)59)38-15-23-44(24-16-38)69-46-30-32-50-52(36-46)58(65)61(56(50)63)40-19-27-42(28-20-40)67-34-4-2/h3-32,35-36H,1-2,33-34H2 |
| InChIKey | RIRWBGFPDRTYGH-UHFFFAOYSA-N |
| XLogP | 12.37 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 904.97 |
| LogP ≤ 5 | 12.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|