C49H38N2O6 — CID 118199746
2-methyl-5-[4-[9-[4-[2-(4-methylcyclohexyl)-1,3-dioxoisoindol-5-yl]oxyphenyl]fluoren-9-yl]phenoxy]isoindole-1,3-dione (PubChem CID 118199746) has the molecular formula C49H38N2O6 and a molecular weight of 750.85 g/mol. Its IUPAC name is 2-methyl-5-[4-[9-[4-[2-(4-methylcyclohexyl)-1,3-dioxoisoindol-5-yl]oxyphenyl]fluoren-9-yl]phenoxy]isoindole-1,3-dione.
| Compound Name | 2-methyl-5-[4-[9-[4-[2-(4-methylcyclohexyl)-1,3-dioxoisoindol-5-yl]oxyphenyl]fluoren-9-yl]phenoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 118199746 |
| Molecular Formula | C49H38N2O6 |
| Molecular Weight | 750.85 g/mol |
| Exact Mass | 750.27 |
| IUPAC Name | 2-methyl-5-[4-[9-[4-[2-(4-methylcyclohexyl)-1,3-dioxoisoindol-5-yl]oxyphenyl]fluoren-9-yl]phenoxy]isoindole-1,3-dione |
| SMILES | CC1CCC(N2C(=O)c3ccc(Oc4ccc(C5(c6ccc(Oc7ccc8c(c7)C(=O)N(C)C8=O)cc6)c6ccccc6-c6ccccc65)cc4)cc3C2=O)CC1 |
| InChI | InChI=1S/C49H38N2O6/c1-29-11-17-32(18-12-29)51-47(54)40-26-24-36(28-42(40)48(51)55)57-34-21-15-31(16-22-34)49(43-9-5-3-7-37(43)38-8-4-6-10-44(38)49)30-13-19-33(20-14-30)56-35-23-25-39-41(27-35)46(53)50(2)45(39)52/h3-10,13-16,19-29,32H,11-12,17-18H2,1-2H3 |
| InChIKey | IDTQSUIAWATETR-UHFFFAOYSA-N |
| XLogP | 10.03 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.85 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|