C41H26N2O6 — CID 122525476
2-[4-[9-[4-(1,5-dihydroxy-3-oxo-1H-isoindol-2-yl)phenyl]fluoren-9-yl]phenyl]-5-hydroxyisoindole-1,3-dione (PubChem CID 122525476) has the molecular formula C41H26N2O6 and a molecular weight of 642.67 g/mol. Its IUPAC name is 2-[4-[9-[4-(1,5-dihydroxy-3-oxo-1H-isoindol-2-yl)phenyl]fluoren-9-yl]phenyl]-5-hydroxyisoindole-1,3-dione.
| Compound Name | 2-[4-[9-[4-(1,5-dihydroxy-3-oxo-1H-isoindol-2-yl)phenyl]fluoren-9-yl]phenyl]-5-hydroxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 122525476 |
| Molecular Formula | C41H26N2O6 |
| Molecular Weight | 642.67 g/mol |
| Exact Mass | 642.18 |
| IUPAC Name | 2-[4-[9-[4-(1,5-dihydroxy-3-oxo-1H-isoindol-2-yl)phenyl]fluoren-9-yl]phenyl]-5-hydroxyisoindole-1,3-dione |
| SMILES | O=C1c2ccc(O)cc2C(=O)N1c1ccc(C2(c3ccc(N4C(=O)c5cc(O)ccc5C4O)cc3)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C41H26N2O6/c44-27-17-19-31-33(21-27)39(48)42(37(31)46)25-13-9-23(10-14-25)41(35-7-3-1-5-29(35)30-6-2-4-8-36(30)41)24-11-15-26(16-12-24)43-38(47)32-20-18-28(45)22-34(32)40(43)49/h1-22,37,44-46H |
| InChIKey | LRLKQZLEYYXRMD-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.67 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|