C41H30N4O7 — CID 59571976
1-[3,5-bis[5-(3-hydroxy-3-methylbut-1-ynyl)-1,3-dioxoisoindol-2-yl]phenyl]-3-(3-ethynylphenyl)urea (PubChem CID 59571976) has the molecular formula C41H30N4O7 and a molecular weight of 690.71 g/mol. Its IUPAC name is 1-[3,5-bis[5-(3-hydroxy-3-methylbut-1-ynyl)-1,3-dioxoisoindol-2-yl]phenyl]-3-(3-ethynylphenyl)urea.
| Compound Name | 1-[3,5-bis[5-(3-hydroxy-3-methylbut-1-ynyl)-1,3-dioxoisoindol-2-yl]phenyl]-3-(3-ethynylphenyl)urea |
|---|---|
| PubChem CID | 59571976 |
| Molecular Formula | C41H30N4O7 |
| Molecular Weight | 690.71 g/mol |
| Exact Mass | 690.21 |
| IUPAC Name | 1-[3,5-bis[5-(3-hydroxy-3-methylbut-1-ynyl)-1,3-dioxoisoindol-2-yl]phenyl]-3-(3-ethynylphenyl)urea |
| SMILES | C#Cc1cccc(NC(=O)Nc2cc(N3C(=O)c4ccc(C#CC(C)(C)O)cc4C3=O)cc(N3C(=O)c4ccc(C#CC(C)(C)O)cc4C3=O)c2)c1 |
| InChI | InChI=1S/C41H30N4O7/c1-6-24-8-7-9-27(18-24)42-39(50)43-28-21-29(44-35(46)31-12-10-25(14-16-40(2,3)51)19-33(31)37(44)48)23-30(22-28)45-36(47)32-13-11-26(15-17-41(4,5)52)20-34(32)38(45)49/h1,7-13,18-23,51-52H,2-5H3,(H2,42,43,50) |
| InChIKey | RCCKNEXDRLFOLN-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 156.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.71 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|