C19H14N2O3 — CID 51332748
2-methyl-1,3-dioxo-N-(3-phenylprop-2-ynyl)isoindole-5-carboxamide (PubChem CID 51332748) has the molecular formula C19H14N2O3 and a molecular weight of 318.33 g/mol. Its IUPAC name is 2-methyl-1,3-dioxo-N-(3-phenylprop-2-ynyl)isoindole-5-carboxamide.
| Compound Name | 2-methyl-1,3-dioxo-N-(3-phenylprop-2-ynyl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 51332748 |
| Molecular Formula | C19H14N2O3 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 2-methyl-1,3-dioxo-N-(3-phenylprop-2-ynyl)isoindole-5-carboxamide |
| SMILES | CN1C(=O)c2ccc(C(=O)NCC#Cc3ccccc3)cc2C1=O |
| InChI | InChI=1S/C19H14N2O3/c1-21-18(23)15-10-9-14(12-16(15)19(21)24)17(22)20-11-5-8-13-6-3-2-4-7-13/h2-4,6-7,9-10,12H,11H2,1H3,(H,20,22) |
| InChIKey | RTLNCUQQKLMUNM-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|