C23H12O6 — CID 147780935
5-[4-(3-oxo-1a,7b-dihydrooxireno[2,3-c]isochromen-5-yl)phenyl]-2-benzofuran-1,3-dione (PubChem CID 147780935) has the molecular formula C23H12O6 and a molecular weight of 384.34 g/mol. Its IUPAC name is 5-[4-(3-oxo-1a,7b-dihydrooxireno[2,3-c]isochromen-5-yl)phenyl]-2-benzofuran-1,3-dione.
| Compound Name | 5-[4-(3-oxo-1a,7b-dihydrooxireno[2,3-c]isochromen-5-yl)phenyl]-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 147780935 |
| Molecular Formula | C23H12O6 |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | 5-[4-(3-oxo-1a,7b-dihydrooxireno[2,3-c]isochromen-5-yl)phenyl]-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2cc(-c3ccc(-c4ccc5c(c4)C(=O)OC4OC54)cc3)ccc21 |
| InChI | InChI=1S/C23H12O6/c24-20-16-8-6-14(10-18(16)21(25)28-20)12-3-1-11(2-4-12)13-5-7-15-17(9-13)22(26)29-23-19(15)27-23/h1-10,19,23H |
| InChIKey | HHTUYGOMSBDNFZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 82.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|