C11H7NO4 — CID 174772569
5-(4,5-dihydro-1,3-oxazol-2-yl)-2-benzofuran-1,3-dione (PubChem CID 174772569) has the molecular formula C11H7NO4 and a molecular weight of 217.18 g/mol. Its IUPAC name is 5-(4,5-dihydro-1,3-oxazol-2-yl)-2-benzofuran-1,3-dione.
| Compound Name | 5-(4,5-dihydro-1,3-oxazol-2-yl)-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 174772569 |
| Molecular Formula | C11H7NO4 |
| Molecular Weight | 217.18 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 5-(4,5-dihydro-1,3-oxazol-2-yl)-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2cc(C3=NCCO3)ccc21 |
| InChI | InChI=1S/C11H7NO4/c13-10-7-2-1-6(9-12-3-4-15-9)5-8(7)11(14)16-10/h1-2,5H,3-4H2 |
| InChIKey | YVNAYJLYIFGEHF-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.18 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|