C30H24N6O3 — CID 135250784
2-[3-[4,6-bis[3-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]-4,5-dihydro-1,3-oxazole (PubChem CID 135250784) has the molecular formula C30H24N6O3 and a molecular weight of 516.56 g/mol. Its IUPAC name is 2-[3-[4,6-bis[3-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-[3-[4,6-bis[3-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 135250784 |
| Molecular Formula | C30H24N6O3 |
| Molecular Weight | 516.56 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | 2-[3-[4,6-bis[3-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-1,3,5-triazin-2-yl]phenyl]-4,5-dihydro-1,3-oxazole |
| SMILES | c1cc(C2=NCCO2)cc(-c2nc(-c3cccc(C4=NCCO4)c3)nc(-c3cccc(C4=NCCO4)c3)n2)c1 |
| InChI | InChI=1S/C30H24N6O3/c1-4-19(16-22(7-1)28-31-10-13-37-28)25-34-26(20-5-2-8-23(17-20)29-32-11-14-38-29)36-27(35-25)21-6-3-9-24(18-21)30-33-12-15-39-30/h1-9,16-18H,10-15H2 |
| InChIKey | ZIGULJWCZZADNK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 103.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.56 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |