C12H12N4O — CID 117328775
4-[3-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-1H-pyrazol-5-amine (PubChem CID 117328775) has the molecular formula C12H12N4O and a molecular weight of 228.25 g/mol. Its IUPAC name is 4-[3-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-1H-pyrazol-5-amine.
| Compound Name | 4-[3-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 117328775 |
| Molecular Formula | C12H12N4O |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 4-[3-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-1H-pyrazol-5-amine |
| SMILES | Nc1[nH]ncc1-c1cccc(C2=NCCO2)c1 |
| InChI | InChI=1S/C12H12N4O/c13-11-10(7-15-16-11)8-2-1-3-9(6-8)12-14-4-5-17-12/h1-3,6-7H,4-5H2,(H3,13,15,16) |
| InChIKey | XRLBHPVLKCESHI-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |