About 4-[2-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-1H-pyrazol-5-amine
4-[2-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-1H-pyrazol-5-amine (PubChem CID 117328774) has the molecular formula C12H12N4O
and a molecular weight of 228.25 g/mol. Its IUPAC name is 4-[2-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-1H-pyrazol-5-amine.
Molecular Properties
| Compound Name | 4-[2-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-1H-pyrazol-5-amine |
| PubChem CID | 117328774 |
| Molecular Formula | C12H12N4O |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 4-[2-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-1H-pyrazol-5-amine |
| SMILES | Nc1[nH]ncc1-c1ccccc1C1=NCCO1 |
| InChI | InChI=1S/C12H12N4O/c13-11-10(7-15-16-11)8-3-1-2-4-9(8)12-14-5-6-17-12/h1-4,7H,5-6H2,(H3,13,15,16) |
| InChIKey | RNKWNCFVXPTAPX-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-1H-pyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-1H-pyrazol-5-amine?
The IUPAC name of 4-[2-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-1H-pyrazol-5-amine (CID 117328774) is 4-[2-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-1H-pyrazol-5-amine.
What is the SMILES notation for 4-[2-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-1H-pyrazol-5-amine?
The canonical SMILES for 4-[2-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-1H-pyrazol-5-amine is Nc1[nH]ncc1-c1ccccc1C1=NCCO1.
What is the InChIKey of 4-[2-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-1H-pyrazol-5-amine?
The InChIKey is RNKWNCFVXPTAPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4O/c13-11-10(7-15-16-11)8-3-1-2-4-9(8)12-14-5-6-17-12/h1-4,7H,5-6H2,(H3,13,15,16).
What are the key properties of 4-[2-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-1H-pyrazol-5-amine?
4-[2-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-1H-pyrazol-5-amine has a molecular weight of 228.25 g/mol, XLogP of 1.44, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-1H-pyrazol-5-amine is sourced from PubChem (CID 117328774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).