About 3-(4,5-dihydro-1,3-oxazol-2-yl)phenol
3-(4,5-dihydro-1,3-oxazol-2-yl)phenol (PubChem CID 139059691) has the molecular formula C18H18N2O4
and a molecular weight of 326.35 g/mol. Its IUPAC name is 3-(4,5-dihydro-1,3-oxazol-2-yl)phenol.
Molecular Properties
| Compound Name | 3-(4,5-dihydro-1,3-oxazol-2-yl)phenol |
| PubChem CID | 139059691 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 3-(4,5-dihydro-1,3-oxazol-2-yl)phenol |
| SMILES | Oc1cccc(C2=NCCO2)c1.Oc1cccc(C2=NCCO2)c1 |
| InChI | InChI=1S/2C9H9NO2/c2*11-8-3-1-2-7(6-8)9-10-4-5-12-9/h2*1-3,6,11H,4-5H2 |
| InChIKey | YAKCRQYMWYZTCW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(4,5-dihydro-1,3-oxazol-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,5-dihydro-1,3-oxazol-2-yl)phenol?
The IUPAC name of 3-(4,5-dihydro-1,3-oxazol-2-yl)phenol (CID 139059691) is 3-(4,5-dihydro-1,3-oxazol-2-yl)phenol.
What is the SMILES notation for 3-(4,5-dihydro-1,3-oxazol-2-yl)phenol?
The canonical SMILES for 3-(4,5-dihydro-1,3-oxazol-2-yl)phenol is Oc1cccc(C2=NCCO2)c1.Oc1cccc(C2=NCCO2)c1.
What is the InChIKey of 3-(4,5-dihydro-1,3-oxazol-2-yl)phenol?
The InChIKey is YAKCRQYMWYZTCW-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H9NO2/c2*11-8-3-1-2-7(6-8)9-10-4-5-12-9/h2*1-3,6,11H,4-5H2.
What are the key properties of 3-(4,5-dihydro-1,3-oxazol-2-yl)phenol?
3-(4,5-dihydro-1,3-oxazol-2-yl)phenol has a molecular weight of 326.35 g/mol, XLogP of 2.34, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,5-dihydro-1,3-oxazol-2-yl)phenol is sourced from PubChem (CID 139059691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).