C18H18N2O4 — CID 139059691
3-(4,5-dihydro-1,3-oxazol-2-yl)phenol (PubChem CID 139059691) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 3-(4,5-dihydro-1,3-oxazol-2-yl)phenol.
| Compound Name | 3-(4,5-dihydro-1,3-oxazol-2-yl)phenol |
|---|---|
| PubChem CID | 139059691 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 3-(4,5-dihydro-1,3-oxazol-2-yl)phenol |
| SMILES | Oc1cccc(C2=NCCO2)c1.Oc1cccc(C2=NCCO2)c1 |
| InChI | InChI=1S/2C9H9NO2/c2*11-8-3-1-2-7(6-8)9-10-4-5-12-9/h2*1-3,6,11H,4-5H2 |
| InChIKey | YAKCRQYMWYZTCW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |