C19H17ClN2O3 — CID 7466038
[2-(2-chloro-4,6-dimethylanilino)-2-oxoethyl] 1H-indole-2-carboxylate (PubChem CID 7466038) has the molecular formula C19H17ClN2O3 and a molecular weight of 356.81 g/mol. Its IUPAC name is [2-(2-chloro-4,6-dimethylanilino)-2-oxoethyl] 1H-indole-2-carboxylate.
| Compound Name | [2-(2-chloro-4,6-dimethylanilino)-2-oxoethyl] 1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 7466038 |
| Molecular Formula | C19H17ClN2O3 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | [2-(2-chloro-4,6-dimethylanilino)-2-oxoethyl] 1H-indole-2-carboxylate |
| SMILES | Cc1cc(C)c(NC(=O)COC(=O)c2cc3ccccc3[nH]2)c(Cl)c1 |
| InChI | InChI=1S/C19H17ClN2O3/c1-11-7-12(2)18(14(20)8-11)22-17(23)10-25-19(24)16-9-13-5-3-4-6-15(13)21-16/h3-9,21H,10H2,1-2H3,(H,22,23) |
| InChIKey | QYNHEYUWZPGFPK-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |