C14H14N2O5 — CID 18777229
(4-methoxycarbonyl-5-methylfuran-2-yl)methyl 5-methylpyrazine-2-carboxylate (PubChem CID 18777229) has the molecular formula C14H14N2O5 and a molecular weight of 290.28 g/mol. Its IUPAC name is (4-methoxycarbonyl-5-methylfuran-2-yl)methyl 5-methylpyrazine-2-carboxylate.
| Compound Name | (4-methoxycarbonyl-5-methylfuran-2-yl)methyl 5-methylpyrazine-2-carboxylate |
|---|---|
| PubChem CID | 18777229 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | (4-methoxycarbonyl-5-methylfuran-2-yl)methyl 5-methylpyrazine-2-carboxylate |
| SMILES | COC(=O)c1cc(COC(=O)c2cnc(C)cn2)oc1C |
| InChI | InChI=1S/C14H14N2O5/c1-8-5-16-12(6-15-8)14(18)20-7-10-4-11(9(2)21-10)13(17)19-3/h4-6H,7H2,1-3H3 |
| InChIKey | ATVNKCLSJBKPSZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 91.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |