C19H24O5 — CID 7867022
methyl 5-(adamantane-1-carbonyloxymethyl)-2-methylfuran-3-carboxylate (PubChem CID 7867022) has the molecular formula C19H24O5 and a molecular weight of 332.40 g/mol. Its IUPAC name is methyl 5-(adamantane-1-carbonyloxymethyl)-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-(adamantane-1-carbonyloxymethyl)-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 7867022 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | methyl 5-(adamantane-1-carbonyloxymethyl)-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1cc(COC(=O)C23CC4CC(CC(C4)C2)C3)oc1C |
| InChI | InChI=1S/C19H24O5/c1-11-16(17(20)22-2)6-15(24-11)10-23-18(21)19-7-12-3-13(8-19)5-14(4-12)9-19/h6,12-14H,3-5,7-10H2,1-2H3 |
| InChIKey | MATZFVRWHGGZEW-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |