C18H14BrNO3 — CID 9487790
1,3-benzoxazol-2-ylmethyl (E)-3-(2-bromo-4-methylphenyl)prop-2-enoate (PubChem CID 9487790) has the molecular formula C18H14BrNO3 and a molecular weight of 372.22 g/mol. Its IUPAC name is 1,3-benzoxazol-2-ylmethyl (E)-3-(2-bromo-4-methylphenyl)prop-2-enoate.
| Compound Name | 1,3-benzoxazol-2-ylmethyl (E)-3-(2-bromo-4-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 9487790 |
| Molecular Formula | C18H14BrNO3 |
| Molecular Weight | 372.22 g/mol |
| Exact Mass | 371.02 |
| IUPAC Name | 1,3-benzoxazol-2-ylmethyl (E)-3-(2-bromo-4-methylphenyl)prop-2-enoate |
| SMILES | Cc1ccc(/C=C/C(=O)OCc2nc3ccccc3o2)c(Br)c1 |
| InChI | InChI=1S/C18H14BrNO3/c1-12-6-7-13(14(19)10-12)8-9-18(21)22-11-17-20-15-4-2-3-5-16(15)23-17/h2-10H,11H2,1H3/b9-8+ |
| InChIKey | PHPUHEJILCPNFP-CMDGGOBGSA-N |
| XLogP | 4.66 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.22 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|