C20H17BrN2O3 — CID 9061162
[(1S)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl] (E)-3-(2-bromo-4-methylphenyl)prop-2-enoate (PubChem CID 9061162) has the molecular formula C20H17BrN2O3 and a molecular weight of 413.27 g/mol. Its IUPAC name is [(1S)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl] (E)-3-(2-bromo-4-methylphenyl)prop-2-enoate.
| Compound Name | [(1S)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl] (E)-3-(2-bromo-4-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 9061162 |
| Molecular Formula | C20H17BrN2O3 |
| Molecular Weight | 413.27 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | [(1S)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl] (E)-3-(2-bromo-4-methylphenyl)prop-2-enoate |
| SMILES | Cc1ccc(/C=C/C(=O)O[C@@H](C)c2nnc(-c3ccccc3)o2)c(Br)c1 |
| InChI | InChI=1S/C20H17BrN2O3/c1-13-8-9-15(17(21)12-13)10-11-18(24)25-14(2)19-22-23-20(26-19)16-6-4-3-5-7-16/h3-12,14H,1-2H3/b11-10+/t14-/m0/s1 |
| InChIKey | ISRFMYMEBRQUCM-VNDWYCCKSA-N |
| XLogP | 5.13 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.27 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|