C20H16BrFN2O3 — CID 18231021
1-[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate (PubChem CID 18231021) has the molecular formula C20H16BrFN2O3 and a molecular weight of 431.26 g/mol. Its IUPAC name is 1-[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate.
| Compound Name | 1-[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 18231021 |
| Molecular Formula | C20H16BrFN2O3 |
| Molecular Weight | 431.26 g/mol |
| Exact Mass | 430.03 |
| IUPAC Name | 1-[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]ethyl (E)-3-(5-bromo-2-fluorophenyl)prop-2-enoate |
| SMILES | Cc1cccc(-c2nnc(C(C)OC(=O)/C=C/c3cc(Br)ccc3F)o2)c1 |
| InChI | InChI=1S/C20H16BrFN2O3/c1-12-4-3-5-15(10-12)20-24-23-19(27-20)13(2)26-18(25)9-6-14-11-16(21)7-8-17(14)22/h3-11,13H,1-2H3/b9-6+ |
| InChIKey | WLCUFZMJNIEOAV-RMKNXTFCSA-N |
| XLogP | 5.26 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.26 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|