C20H15F3N2O3 — CID 7630019
[(1R)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate (PubChem CID 7630019) has the molecular formula C20H15F3N2O3 and a molecular weight of 388.35 g/mol. Its IUPAC name is [(1R)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate.
| Compound Name | [(1R)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 7630019 |
| Molecular Formula | C20H15F3N2O3 |
| Molecular Weight | 388.35 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | [(1R)-1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethyl] (E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoate |
| SMILES | C[C@@H](OC(=O)/C=C/c1ccc(C(F)(F)F)cc1)c1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C20H15F3N2O3/c1-13(18-24-25-19(28-18)15-5-3-2-4-6-15)27-17(26)12-9-14-7-10-16(11-8-14)20(21,22)23/h2-13H,1H3/b12-9+/t13-/m1/s1 |
| InChIKey | RYUXXXOYDXSFNS-CNELAYHGSA-N |
| XLogP | 5.07 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.35 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|