C23H22ClNO6S — CID 16596113
[2-[(4-chlorophenoxy)methyl]-1,3-thiazol-4-yl]methyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 16596113) has the molecular formula C23H22ClNO6S and a molecular weight of 475.95 g/mol. Its IUPAC name is [2-[(4-chlorophenoxy)methyl]-1,3-thiazol-4-yl]methyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-[(4-chlorophenoxy)methyl]-1,3-thiazol-4-yl]methyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 16596113 |
| Molecular Formula | C23H22ClNO6S |
| Molecular Weight | 475.95 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | [2-[(4-chlorophenoxy)methyl]-1,3-thiazol-4-yl]methyl (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCc2csc(COc3ccc(Cl)cc3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C23H22ClNO6S/c1-27-19-10-15(11-20(28-2)23(19)29-3)4-9-22(26)31-12-17-14-32-21(25-17)13-30-18-7-5-16(24)6-8-18/h4-11,14H,12-13H2,1-3H3/b9-4+ |
| InChIKey | ZWFZIZNDFHZQMS-RUDMXATFSA-N |
| XLogP | 5.16 |
| TPSA | 76.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.95 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|