C22H20FNO4S — CID 8937694
[2-[(4-fluorophenoxy)methyl]-1,3-thiazol-4-yl]methyl (E)-3-(2-ethoxyphenyl)prop-2-enoate (PubChem CID 8937694) has the molecular formula C22H20FNO4S and a molecular weight of 413.47 g/mol. Its IUPAC name is [2-[(4-fluorophenoxy)methyl]-1,3-thiazol-4-yl]methyl (E)-3-(2-ethoxyphenyl)prop-2-enoate.
| Compound Name | [2-[(4-fluorophenoxy)methyl]-1,3-thiazol-4-yl]methyl (E)-3-(2-ethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8937694 |
| Molecular Formula | C22H20FNO4S |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | [2-[(4-fluorophenoxy)methyl]-1,3-thiazol-4-yl]methyl (E)-3-(2-ethoxyphenyl)prop-2-enoate |
| SMILES | CCOc1ccccc1/C=C/C(=O)OCc1csc(COc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C22H20FNO4S/c1-2-26-20-6-4-3-5-16(20)7-12-22(25)28-13-18-15-29-21(24-18)14-27-19-10-8-17(23)9-11-19/h3-12,15H,2,13-14H2,1H3/b12-7+ |
| InChIKey | ZFTYXEHPCMQSRS-KPKJPENVSA-N |
| XLogP | 5.02 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|