C23H19ClN2O5S — CID 16592664
[2-[(4-chlorophenoxy)methyl]-1,3-thiazol-4-yl]methyl (E)-3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enoate (PubChem CID 16592664) has the molecular formula C23H19ClN2O5S and a molecular weight of 470.93 g/mol. Its IUPAC name is [2-[(4-chlorophenoxy)methyl]-1,3-thiazol-4-yl]methyl (E)-3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enoate.
| Compound Name | [2-[(4-chlorophenoxy)methyl]-1,3-thiazol-4-yl]methyl (E)-3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 16592664 |
| Molecular Formula | C23H19ClN2O5S |
| Molecular Weight | 470.93 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | [2-[(4-chlorophenoxy)methyl]-1,3-thiazol-4-yl]methyl (E)-3-[4-(cyanomethoxy)-3-methoxyphenyl]prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCc2csc(COc3ccc(Cl)cc3)n2)ccc1OCC#N |
| InChI | InChI=1S/C23H19ClN2O5S/c1-28-21-12-16(2-8-20(21)29-11-10-25)3-9-23(27)31-13-18-15-32-22(26-18)14-30-19-6-4-17(24)5-7-19/h2-9,12,15H,11,13-14H2,1H3/b9-3+ |
| InChIKey | GSMPKXJZKCKWAO-YCRREMRBSA-N |
| XLogP | 5.04 |
| TPSA | 90.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.93 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|