C16H13F4NO3 — CID 118340396
[1-(4-fluorophenyl)-2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]carbamic acid (PubChem CID 118340396) has the molecular formula C16H13F4NO3 and a molecular weight of 343.28 g/mol. Its IUPAC name is [1-(4-fluorophenyl)-2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]carbamic acid.
| Compound Name | [1-(4-fluorophenyl)-2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]carbamic acid |
|---|---|
| PubChem CID | 118340396 |
| Molecular Formula | C16H13F4NO3 |
| Molecular Weight | 343.28 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | [1-(4-fluorophenyl)-2-hydroxy-2-[3-(trifluoromethyl)phenyl]ethyl]carbamic acid |
| SMILES | O=C(O)NC(c1ccc(F)cc1)C(O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H13F4NO3/c17-12-6-4-9(5-7-12)13(21-15(23)24)14(22)10-2-1-3-11(8-10)16(18,19)20/h1-8,13-14,21-22H,(H,23,24) |
| InChIKey | VFUDPBHWJNXMAR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.28 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |