C17H13F4O3- — CID 22261948
3-(4-fluorophenyl)-3-hydroxy-2-[[3-(trifluoromethyl)phenyl]methyl]propanoate (PubChem CID 22261948) has the molecular formula C17H13F4O3- and a molecular weight of 341.28 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-3-hydroxy-2-[[3-(trifluoromethyl)phenyl]methyl]propanoate.
| Compound Name | 3-(4-fluorophenyl)-3-hydroxy-2-[[3-(trifluoromethyl)phenyl]methyl]propanoate |
|---|---|
| PubChem CID | 22261948 |
| Molecular Formula | C17H13F4O3- |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 3-(4-fluorophenyl)-3-hydroxy-2-[[3-(trifluoromethyl)phenyl]methyl]propanoate |
| SMILES | O=C([O-])C(Cc1cccc(C(F)(F)F)c1)C(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H14F4O3/c18-13-6-4-11(5-7-13)15(22)14(16(23)24)9-10-2-1-3-12(8-10)17(19,20)21/h1-8,14-15,22H,9H2,(H,23,24)/p-1 |
| InChIKey | HQTZDDMHEMRURQ-UHFFFAOYSA-M |
| XLogP | 2.49 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |