C19H18F4O3 — CID 22261474
ethyl 2-[(4-fluorophenyl)methyl]-3-hydroxy-3-[4-(trifluoromethyl)phenyl]propanoate (PubChem CID 22261474) has the molecular formula C19H18F4O3 and a molecular weight of 370.34 g/mol. Its IUPAC name is ethyl 2-[(4-fluorophenyl)methyl]-3-hydroxy-3-[4-(trifluoromethyl)phenyl]propanoate.
| Compound Name | ethyl 2-[(4-fluorophenyl)methyl]-3-hydroxy-3-[4-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 22261474 |
| Molecular Formula | C19H18F4O3 |
| Molecular Weight | 370.34 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | ethyl 2-[(4-fluorophenyl)methyl]-3-hydroxy-3-[4-(trifluoromethyl)phenyl]propanoate |
| SMILES | CCOC(=O)C(Cc1ccc(F)cc1)C(O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H18F4O3/c1-2-26-18(25)16(11-12-3-9-15(20)10-4-12)17(24)13-5-7-14(8-6-13)19(21,22)23/h3-10,16-17,24H,2,11H2,1H3 |
| InChIKey | BNXZNKYIHDHGIK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.34 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |