C17H17FO4 — CID 22261867
3-(4-fluorophenyl)-3-hydroxy-2-[(4-methoxyphenyl)methyl]propanoic acid (PubChem CID 22261867) has the molecular formula C17H17FO4 and a molecular weight of 304.32 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-3-hydroxy-2-[(4-methoxyphenyl)methyl]propanoic acid.
| Compound Name | 3-(4-fluorophenyl)-3-hydroxy-2-[(4-methoxyphenyl)methyl]propanoic acid |
|---|---|
| PubChem CID | 22261867 |
| Molecular Formula | C17H17FO4 |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 3-(4-fluorophenyl)-3-hydroxy-2-[(4-methoxyphenyl)methyl]propanoic acid |
| SMILES | COc1ccc(CC(C(=O)O)C(O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H17FO4/c1-22-14-8-2-11(3-9-14)10-15(17(20)21)16(19)12-4-6-13(18)7-5-12/h2-9,15-16,19H,10H2,1H3,(H,20,21) |
| InChIKey | WIAFBTAYXBVKMX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |