C23H28FNO3 — CID 22261959
N-[1-(4-fluorophenyl)-1-hydroxy-3-(4-methoxyphenyl)propan-2-yl]cyclohexanecarboxamide (PubChem CID 22261959) has the molecular formula C23H28FNO3 and a molecular weight of 385.48 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)-1-hydroxy-3-(4-methoxyphenyl)propan-2-yl]cyclohexanecarboxamide.
| Compound Name | N-[1-(4-fluorophenyl)-1-hydroxy-3-(4-methoxyphenyl)propan-2-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 22261959 |
| Molecular Formula | C23H28FNO3 |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | N-[1-(4-fluorophenyl)-1-hydroxy-3-(4-methoxyphenyl)propan-2-yl]cyclohexanecarboxamide |
| SMILES | COc1ccc(CC(NC(=O)C2CCCCC2)C(O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H28FNO3/c1-28-20-13-7-16(8-14-20)15-21(22(26)17-9-11-19(24)12-10-17)25-23(27)18-5-3-2-4-6-18/h7-14,18,21-22,26H,2-6,15H2,1H3,(H,25,27) |
| InChIKey | GFSVQNCWSTVIRP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |