About N-[1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]cyclohexanecarboxamide
N-[1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]cyclohexanecarboxamide (PubChem CID 54852807) has the molecular formula C16H24N2O3
and a molecular weight of 292.38 g/mol. Its IUPAC name is N-[1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]cyclohexanecarboxamide.
Molecular Properties
| Compound Name | N-[1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]cyclohexanecarboxamide |
| PubChem CID | 54852807 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | N-[1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]cyclohexanecarboxamide |
| SMILES | Nc1ccc(C(O)C(CO)NC(=O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C16H24N2O3/c17-13-8-6-11(7-9-13)15(20)14(10-19)18-16(21)12-4-2-1-3-5-12/h6-9,12,14-15,19-20H,1-5,10,17H2,(H,18,21) |
| InChIKey | KOKURKRTVCBPJO-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]cyclohexanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]cyclohexanecarboxamide?
The IUPAC name of N-[1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]cyclohexanecarboxamide (CID 54852807) is N-[1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]cyclohexanecarboxamide.
What is the SMILES notation for N-[1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]cyclohexanecarboxamide?
The canonical SMILES for N-[1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]cyclohexanecarboxamide is Nc1ccc(C(O)C(CO)NC(=O)C2CCCCC2)cc1.
What is the InChIKey of N-[1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]cyclohexanecarboxamide?
The InChIKey is KOKURKRTVCBPJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O3/c17-13-8-6-11(7-9-13)15(20)14(10-19)18-16(21)12-4-2-1-3-5-12/h6-9,12,14-15,19-20H,1-5,10,17H2,(H,18,21).
What are the key properties of N-[1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]cyclohexanecarboxamide?
N-[1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]cyclohexanecarboxamide has a molecular weight of 292.38 g/mol, XLogP of 1.36, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(4-aminophenyl)-1,3-dihydroxypropan-2-yl]cyclohexanecarboxamide is sourced from PubChem (CID 54852807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).