C17H13F5O3 — CID 22261853
3-(4-fluorophenyl)-2-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]-3-hydroxypropanoic acid (PubChem CID 22261853) has the molecular formula C17H13F5O3 and a molecular weight of 360.28 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-2-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]-3-hydroxypropanoic acid.
| Compound Name | 3-(4-fluorophenyl)-2-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 22261853 |
| Molecular Formula | C17H13F5O3 |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 3-(4-fluorophenyl)-2-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]-3-hydroxypropanoic acid |
| SMILES | O=C(O)C(Cc1ccc(C(F)(F)F)c(F)c1)C(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H13F5O3/c18-11-4-2-10(3-5-11)15(23)12(16(24)25)7-9-1-6-13(14(19)8-9)17(20,21)22/h1-6,8,12,15,23H,7H2,(H,24,25) |
| InChIKey | HDSOSBXVGPGVMM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |