C21H21F5O4 — CID 22261567
ethyl 3-(4-fluorophenyl)-3-hydroxy-2-[[4-methyl-3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]propanoate (PubChem CID 22261567) has the molecular formula C21H21F5O4 and a molecular weight of 432.39 g/mol. Its IUPAC name is ethyl 3-(4-fluorophenyl)-3-hydroxy-2-[[4-methyl-3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]propanoate.
| Compound Name | ethyl 3-(4-fluorophenyl)-3-hydroxy-2-[[4-methyl-3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]propanoate |
|---|---|
| PubChem CID | 22261567 |
| Molecular Formula | C21H21F5O4 |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | ethyl 3-(4-fluorophenyl)-3-hydroxy-2-[[4-methyl-3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]propanoate |
| SMILES | CCOC(=O)C(Cc1ccc(C)c(OC(F)(F)C(F)F)c1)C(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H21F5O4/c1-3-29-19(28)16(18(27)14-6-8-15(22)9-7-14)10-13-5-4-12(2)17(11-13)30-21(25,26)20(23)24/h4-9,11,16,18,20,27H,3,10H2,1-2H3 |
| InChIKey | XYTGQCKTVYUKQH-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|