C17H14F4O4 — CID 22261415
3-(4-fluorophenyl)-3-hydroxy-2-[[3-(trifluoromethoxy)phenyl]methyl]propanoic acid (PubChem CID 22261415) has the molecular formula C17H14F4O4 and a molecular weight of 358.29 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-3-hydroxy-2-[[3-(trifluoromethoxy)phenyl]methyl]propanoic acid.
| Compound Name | 3-(4-fluorophenyl)-3-hydroxy-2-[[3-(trifluoromethoxy)phenyl]methyl]propanoic acid |
|---|---|
| PubChem CID | 22261415 |
| Molecular Formula | C17H14F4O4 |
| Molecular Weight | 358.29 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 3-(4-fluorophenyl)-3-hydroxy-2-[[3-(trifluoromethoxy)phenyl]methyl]propanoic acid |
| SMILES | O=C(O)C(Cc1cccc(OC(F)(F)F)c1)C(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H14F4O4/c18-12-6-4-11(5-7-12)15(22)14(16(23)24)9-10-2-1-3-13(8-10)25-17(19,20)21/h1-8,14-15,22H,9H2,(H,23,24) |
| InChIKey | PDAXKWDOVWVRKZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.29 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |