C16H15F4NO — CID 138490004
3-amino-1-(4-fluorophenyl)-1-[3-(trifluoromethyl)phenyl]propan-2-ol (PubChem CID 138490004) has the molecular formula C16H15F4NO and a molecular weight of 313.29 g/mol. Its IUPAC name is 3-amino-1-(4-fluorophenyl)-1-[3-(trifluoromethyl)phenyl]propan-2-ol.
| Compound Name | 3-amino-1-(4-fluorophenyl)-1-[3-(trifluoromethyl)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 138490004 |
| Molecular Formula | C16H15F4NO |
| Molecular Weight | 313.29 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 3-amino-1-(4-fluorophenyl)-1-[3-(trifluoromethyl)phenyl]propan-2-ol |
| SMILES | NCC(O)C(c1ccc(F)cc1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H15F4NO/c17-13-6-4-10(5-7-13)15(14(22)9-21)11-2-1-3-12(8-11)16(18,19)20/h1-8,14-15,22H,9,21H2 |
| InChIKey | FHVWASDTHOHOPR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |