C23H26F3N3O2 — CID 86938995
1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-3-[1-[3-(trifluoromethyl)phenyl]ethyl]urea (PubChem CID 86938995) has the molecular formula C23H26F3N3O2 and a molecular weight of 433.47 g/mol. Its IUPAC name is 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-3-[1-[3-(trifluoromethyl)phenyl]ethyl]urea.
| Compound Name | 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-3-[1-[3-(trifluoromethyl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 86938995 |
| Molecular Formula | C23H26F3N3O2 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-3-[1-[3-(trifluoromethyl)phenyl]ethyl]urea |
| SMILES | CC(NC(=O)NCCCC(=O)N1CCc2ccccc2C1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H26F3N3O2/c1-16(18-8-4-9-20(14-18)23(24,25)26)28-22(31)27-12-5-10-21(30)29-13-11-17-6-2-3-7-19(17)15-29/h2-4,6-9,14,16H,5,10-13,15H2,1H3,(H2,27,28,31) |
| InChIKey | UTMYHRVIEFSUGE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|