C17H22F3N3O2 — CID 51126470
1-methyl-1-(2-oxo-2-pyrrolidin-1-ylethyl)-3-[1-[3-(trifluoromethyl)phenyl]ethyl]urea (PubChem CID 51126470) has the molecular formula C17H22F3N3O2 and a molecular weight of 357.38 g/mol. Its IUPAC name is 1-methyl-1-(2-oxo-2-pyrrolidin-1-ylethyl)-3-[1-[3-(trifluoromethyl)phenyl]ethyl]urea.
| Compound Name | 1-methyl-1-(2-oxo-2-pyrrolidin-1-ylethyl)-3-[1-[3-(trifluoromethyl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 51126470 |
| Molecular Formula | C17H22F3N3O2 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 1-methyl-1-(2-oxo-2-pyrrolidin-1-ylethyl)-3-[1-[3-(trifluoromethyl)phenyl]ethyl]urea |
| SMILES | CC(NC(=O)N(C)CC(=O)N1CCCC1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H22F3N3O2/c1-12(13-6-5-7-14(10-13)17(18,19)20)21-16(25)22(2)11-15(24)23-8-3-4-9-23/h5-7,10,12H,3-4,8-9,11H2,1-2H3,(H,21,25) |
| InChIKey | ZPSSPIJAYKKVEJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |