C17H25F3N2O — CID 175464376
1-heptan-2-yl-3-[1-[3-(trifluoromethyl)phenyl]ethyl]urea (PubChem CID 175464376) has the molecular formula C17H25F3N2O and a molecular weight of 330.39 g/mol. Its IUPAC name is 1-heptan-2-yl-3-[1-[3-(trifluoromethyl)phenyl]ethyl]urea.
| Compound Name | 1-heptan-2-yl-3-[1-[3-(trifluoromethyl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 175464376 |
| Molecular Formula | C17H25F3N2O |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 1-heptan-2-yl-3-[1-[3-(trifluoromethyl)phenyl]ethyl]urea |
| SMILES | CCCCCC(C)NC(=O)NC(C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H25F3N2O/c1-4-5-6-8-12(2)21-16(23)22-13(3)14-9-7-10-15(11-14)17(18,19)20/h7,9-13H,4-6,8H2,1-3H3,(H2,21,22,23) |
| InChIKey | HRQBBHJCPYNJFA-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|