C21H16F3N3O5 — CID 41185478
[2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl] 5-methyl-2-phenyl-1,3-oxazole-4-carboxylate (PubChem CID 41185478) has the molecular formula C21H16F3N3O5 and a molecular weight of 447.37 g/mol. Its IUPAC name is [2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl] 5-methyl-2-phenyl-1,3-oxazole-4-carboxylate.
| Compound Name | [2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl] 5-methyl-2-phenyl-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 41185478 |
| Molecular Formula | C21H16F3N3O5 |
| Molecular Weight | 447.37 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | [2-oxo-2-[[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]amino]ethyl] 5-methyl-2-phenyl-1,3-oxazole-4-carboxylate |
| SMILES | Cc1oc(-c2ccccc2)nc1C(=O)OCC(=O)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C21H16F3N3O5/c1-11-19(27-20(32-11)12-5-3-2-4-6-12)21(30)31-10-16(29)25-9-15(28)26-14-8-7-13(22)17(23)18(14)24/h2-8H,9-10H2,1H3,(H,25,29)(H,26,28) |
| InChIKey | RJDOVVYDIQOBCF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|