C9H16N4 — CID 117044524
2-N-(3-amino-2-methylpropyl)pyridine-2,5-diamine (PubChem CID 117044524) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-N-(3-amino-2-methylpropyl)pyridine-2,5-diamine.
| Compound Name | 2-N-(3-amino-2-methylpropyl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 117044524 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 2-N-(3-amino-2-methylpropyl)pyridine-2,5-diamine |
| SMILES | CC(CN)CNc1ccc(N)cn1 |
| InChI | InChI=1S/C9H16N4/c1-7(4-10)5-12-9-3-2-8(11)6-13-9/h2-3,6-7H,4-5,10-11H2,1H3,(H,12,13) |
| InChIKey | ZFNPHSVHWLSXKW-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |