C13H15N3O2S — CID 168596269
3-(2-pyrimidin-2-ylsulfanylanilino)propane-1,2-diol (PubChem CID 168596269) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is 3-(2-pyrimidin-2-ylsulfanylanilino)propane-1,2-diol.
| Compound Name | 3-(2-pyrimidin-2-ylsulfanylanilino)propane-1,2-diol |
|---|---|
| PubChem CID | 168596269 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 3-(2-pyrimidin-2-ylsulfanylanilino)propane-1,2-diol |
| SMILES | OCC(O)CNc1ccccc1Sc1ncccn1 |
| InChI | InChI=1S/C13H15N3O2S/c17-9-10(18)8-16-11-4-1-2-5-12(11)19-13-14-6-3-7-15-13/h1-7,10,16-18H,8-9H2 |
| InChIKey | UBTVOKSRGQFIKZ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |