About 3-[[3-(trifluoromethyl)-2-pyridinyl]amino]propane-1,2-diol
3-[[3-(trifluoromethyl)-2-pyridinyl]amino]propane-1,2-diol (PubChem CID 66177550) has the molecular formula C9H11F3N2O2
and a molecular weight of 236.19 g/mol. Its IUPAC name is 3-[[3-(trifluoromethyl)-2-pyridinyl]amino]propane-1,2-diol.
Molecular Properties
| Compound Name | 3-[[3-(trifluoromethyl)-2-pyridinyl]amino]propane-1,2-diol |
| PubChem CID | 66177550 |
| Molecular Formula | C9H11F3N2O2 |
| Molecular Weight | 236.19 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 3-[[3-(trifluoromethyl)-2-pyridinyl]amino]propane-1,2-diol |
| SMILES | OCC(O)CNc1ncccc1C(F)(F)F |
| InChI | InChI=1S/C9H11F3N2O2/c10-9(11,12)7-2-1-3-13-8(7)14-4-6(16)5-15/h1-3,6,15-16H,4-5H2,(H,13,14) |
| InChIKey | MSFOEEPWYOTKPI-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.19 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[3-(trifluoromethyl)-2-pyridinyl]amino]propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[3-(trifluoromethyl)-2-pyridinyl]amino]propane-1,2-diol?
The IUPAC name of 3-[[3-(trifluoromethyl)-2-pyridinyl]amino]propane-1,2-diol (CID 66177550) is 3-[[3-(trifluoromethyl)-2-pyridinyl]amino]propane-1,2-diol.
What is the SMILES notation for 3-[[3-(trifluoromethyl)-2-pyridinyl]amino]propane-1,2-diol?
The canonical SMILES for 3-[[3-(trifluoromethyl)-2-pyridinyl]amino]propane-1,2-diol is OCC(O)CNc1ncccc1C(F)(F)F.
What is the InChIKey of 3-[[3-(trifluoromethyl)-2-pyridinyl]amino]propane-1,2-diol?
The InChIKey is MSFOEEPWYOTKPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F3N2O2/c10-9(11,12)7-2-1-3-13-8(7)14-4-6(16)5-15/h1-3,6,15-16H,4-5H2,(H,13,14).
What are the key properties of 3-[[3-(trifluoromethyl)-2-pyridinyl]amino]propane-1,2-diol?
3-[[3-(trifluoromethyl)-2-pyridinyl]amino]propane-1,2-diol has a molecular weight of 236.19 g/mol, XLogP of 0.87, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[3-(trifluoromethyl)-2-pyridinyl]amino]propane-1,2-diol is sourced from PubChem (CID 66177550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).