C16H18FNO2S — CID 168597558
3-[2-[(2-fluorophenyl)methylsulfanyl]anilino]propane-1,2-diol (PubChem CID 168597558) has the molecular formula C16H18FNO2S and a molecular weight of 307.39 g/mol. Its IUPAC name is 3-[2-[(2-fluorophenyl)methylsulfanyl]anilino]propane-1,2-diol.
| Compound Name | 3-[2-[(2-fluorophenyl)methylsulfanyl]anilino]propane-1,2-diol |
|---|---|
| PubChem CID | 168597558 |
| Molecular Formula | C16H18FNO2S |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 3-[2-[(2-fluorophenyl)methylsulfanyl]anilino]propane-1,2-diol |
| SMILES | OCC(O)CNc1ccccc1SCc1ccccc1F |
| InChI | InChI=1S/C16H18FNO2S/c17-14-6-2-1-5-12(14)11-21-16-8-4-3-7-15(16)18-9-13(20)10-19/h1-8,13,18-20H,9-11H2 |
| InChIKey | YBINXVLEBSDCMO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |