C12H20N2OS — CID 107644664
1-(dimethylamino)-3-(2-methylsulfanylanilino)propan-2-ol (PubChem CID 107644664) has the molecular formula C12H20N2OS and a molecular weight of 240.37 g/mol. Its IUPAC name is 1-(dimethylamino)-3-(2-methylsulfanylanilino)propan-2-ol.
| Compound Name | 1-(dimethylamino)-3-(2-methylsulfanylanilino)propan-2-ol |
|---|---|
| PubChem CID | 107644664 |
| Molecular Formula | C12H20N2OS |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 1-(dimethylamino)-3-(2-methylsulfanylanilino)propan-2-ol |
| SMILES | CSc1ccccc1NCC(O)CN(C)C |
| InChI | InChI=1S/C12H20N2OS/c1-14(2)9-10(15)8-13-11-6-4-5-7-12(11)16-3/h4-7,10,13,15H,8-9H2,1-3H3 |
| InChIKey | WIBZPHZFTWIKNX-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |