C15H18N2O5S — CID 168595239
2-(2,3-dihydroxypropylamino)-N-(4-hydroxyphenyl)benzenesulfonamide (PubChem CID 168595239) has the molecular formula C15H18N2O5S and a molecular weight of 338.39 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropylamino)-N-(4-hydroxyphenyl)benzenesulfonamide.
| Compound Name | 2-(2,3-dihydroxypropylamino)-N-(4-hydroxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 168595239 |
| Molecular Formula | C15H18N2O5S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 2-(2,3-dihydroxypropylamino)-N-(4-hydroxyphenyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(O)cc1)c1ccccc1NCC(O)CO |
| InChI | InChI=1S/C15H18N2O5S/c18-10-13(20)9-16-14-3-1-2-4-15(14)23(21,22)17-11-5-7-12(19)8-6-11/h1-8,13,16-20H,9-10H2 |
| InChIKey | BTZHEGNWEYHCSD-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|