C9H16BrN5O — CID 106138742
5-[(5-bromo-6-hydrazinylpyrimidin-4-yl)amino]pentan-2-ol (PubChem CID 106138742) has the molecular formula C9H16BrN5O and a molecular weight of 290.17 g/mol. Its IUPAC name is 5-[(5-bromo-6-hydrazinylpyrimidin-4-yl)amino]pentan-2-ol.
| Compound Name | 5-[(5-bromo-6-hydrazinylpyrimidin-4-yl)amino]pentan-2-ol |
|---|---|
| PubChem CID | 106138742 |
| Molecular Formula | C9H16BrN5O |
| Molecular Weight | 290.17 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 5-[(5-bromo-6-hydrazinylpyrimidin-4-yl)amino]pentan-2-ol |
| SMILES | CC(O)CCCNc1ncnc(NN)c1Br |
| InChI | InChI=1S/C9H16BrN5O/c1-6(16)3-2-4-12-8-7(10)9(15-11)14-5-13-8/h5-6,16H,2-4,11H2,1H3,(H2,12,13,14,15) |
| InChIKey | IWEJSBOOMQOUHJ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.17 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|