C16H24N4S — CID 51890557
N'-cyclohexyl-N'-methyl-N-thieno[3,2-d]pyrimidin-4-ylpropane-1,3-diamine (PubChem CID 51890557) has the molecular formula C16H24N4S and a molecular weight of 304.46 g/mol. Its IUPAC name is N'-cyclohexyl-N'-methyl-N-thieno[3,2-d]pyrimidin-4-ylpropane-1,3-diamine.
| Compound Name | N'-cyclohexyl-N'-methyl-N-thieno[3,2-d]pyrimidin-4-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 51890557 |
| Molecular Formula | C16H24N4S |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | N'-cyclohexyl-N'-methyl-N-thieno[3,2-d]pyrimidin-4-ylpropane-1,3-diamine |
| SMILES | CN(CCCNc1ncnc2ccsc12)C1CCCCC1 |
| InChI | InChI=1S/C16H24N4S/c1-20(13-6-3-2-4-7-13)10-5-9-17-16-15-14(8-11-21-15)18-12-19-16/h8,11-13H,2-7,9-10H2,1H3,(H,17,18,19) |
| InChIKey | PEQGHVDHZASWOH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|