C14H19N3S — CID 114095045
N-[(1-methylcyclohexyl)methyl]thieno[3,2-d]pyrimidin-4-amine (PubChem CID 114095045) has the molecular formula C14H19N3S and a molecular weight of 261.39 g/mol. Its IUPAC name is N-[(1-methylcyclohexyl)methyl]thieno[3,2-d]pyrimidin-4-amine.
| Compound Name | N-[(1-methylcyclohexyl)methyl]thieno[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 114095045 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | N-[(1-methylcyclohexyl)methyl]thieno[3,2-d]pyrimidin-4-amine |
| SMILES | CC1(CNc2ncnc3ccsc23)CCCCC1 |
| InChI | InChI=1S/C14H19N3S/c1-14(6-3-2-4-7-14)9-15-13-12-11(5-8-18-12)16-10-17-13/h5,8,10H,2-4,6-7,9H2,1H3,(H,15,16,17) |
| InChIKey | SPXGEIMBFCNNPC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |