C13H17N5O — CID 106281036
3-(3-aminophenyl)-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]propanamide (PubChem CID 106281036) has the molecular formula C13H17N5O and a molecular weight of 259.31 g/mol. Its IUPAC name is 3-(3-aminophenyl)-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]propanamide.
| Compound Name | 3-(3-aminophenyl)-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 106281036 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 3-(3-aminophenyl)-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]propanamide |
| SMILES | CC(NC(=O)CCc1cccc(N)c1)c1ncn[nH]1 |
| InChI | InChI=1S/C13H17N5O/c1-9(13-15-8-16-18-13)17-12(19)6-5-10-3-2-4-11(14)7-10/h2-4,7-9H,5-6,14H2,1H3,(H,17,19)(H,15,16,18) |
| InChIKey | RCJGSMFZDXXZON-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|