C14H18N4O — CID 103725941
3-(2-methylphenyl)-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]propanamide (PubChem CID 103725941) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is 3-(2-methylphenyl)-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]propanamide.
| Compound Name | 3-(2-methylphenyl)-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 103725941 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 3-(2-methylphenyl)-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]propanamide |
| SMILES | Cc1ccccc1CCC(=O)NC(C)c1ncn[nH]1 |
| InChI | InChI=1S/C14H18N4O/c1-10-5-3-4-6-12(10)7-8-13(19)17-11(2)14-15-9-16-18-14/h3-6,9,11H,7-8H2,1-2H3,(H,17,19)(H,15,16,18) |
| InChIKey | YBSMXJSPHDEURH-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |