C27H17BrFN3O4S — CID 83278847
N-[3-[4-(4-bromoanilino)-1-(4-fluorophenyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]furan-2-carboxamide (PubChem CID 83278847) has the molecular formula C27H17BrFN3O4S and a molecular weight of 578.42 g/mol. Its IUPAC name is N-[3-[4-(4-bromoanilino)-1-(4-fluorophenyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]furan-2-carboxamide.
| Compound Name | N-[3-[4-(4-bromoanilino)-1-(4-fluorophenyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 83278847 |
| Molecular Formula | C27H17BrFN3O4S |
| Molecular Weight | 578.42 g/mol |
| Exact Mass | 577.01 |
| IUPAC Name | N-[3-[4-(4-bromoanilino)-1-(4-fluorophenyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cccc(SC2=C(Nc3ccc(Br)cc3)C(=O)N(c3ccc(F)cc3)C2=O)c1)c1ccco1 |
| InChI | InChI=1S/C27H17BrFN3O4S/c28-16-6-10-18(11-7-16)30-23-24(27(35)32(26(23)34)20-12-8-17(29)9-13-20)37-21-4-1-3-19(15-21)31-25(33)22-5-2-14-36-22/h1-15,30H,(H,31,33) |
| InChIKey | LDWDERIFZPLRFF-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.42 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|