C32H26FN3O6S — CID 83274564
N-[3-[4-(4-fluoroanilino)-1-(4-methoxyphenyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-2,4-dimethoxybenzamide (PubChem CID 83274564) has the molecular formula C32H26FN3O6S and a molecular weight of 599.64 g/mol. Its IUPAC name is N-[3-[4-(4-fluoroanilino)-1-(4-methoxyphenyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-2,4-dimethoxybenzamide.
| Compound Name | N-[3-[4-(4-fluoroanilino)-1-(4-methoxyphenyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 83274564 |
| Molecular Formula | C32H26FN3O6S |
| Molecular Weight | 599.64 g/mol |
| Exact Mass | 599.15 |
| IUPAC Name | N-[3-[4-(4-fluoroanilino)-1-(4-methoxyphenyl)-2,5-dioxopyrrol-3-yl]sulfanylphenyl]-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(N2C(=O)C(Nc3ccc(F)cc3)=C(Sc3cccc(NC(=O)c4ccc(OC)cc4OC)c3)C2=O)cc1 |
| InChI | InChI=1S/C32H26FN3O6S/c1-40-23-13-11-22(12-14-23)36-31(38)28(34-20-9-7-19(33)8-10-20)29(32(36)39)43-25-6-4-5-21(17-25)35-30(37)26-16-15-24(41-2)18-27(26)42-3/h4-18,34H,1-3H3,(H,35,37) |
| InChIKey | BOBNUWMTRBJDLC-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.64 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|