C31H33N3O4S — CID 71956925
N-[3-[1-(4-methoxyphenyl)-2,5-dioxo-4-(4-propan-2-ylanilino)pyrrol-3-yl]sulfanylphenyl]-3-methylbutanamide (PubChem CID 71956925) has the molecular formula C31H33N3O4S and a molecular weight of 543.69 g/mol. Its IUPAC name is N-[3-[1-(4-methoxyphenyl)-2,5-dioxo-4-(4-propan-2-ylanilino)pyrrol-3-yl]sulfanylphenyl]-3-methylbutanamide.
| Compound Name | N-[3-[1-(4-methoxyphenyl)-2,5-dioxo-4-(4-propan-2-ylanilino)pyrrol-3-yl]sulfanylphenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 71956925 |
| Molecular Formula | C31H33N3O4S |
| Molecular Weight | 543.69 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | N-[3-[1-(4-methoxyphenyl)-2,5-dioxo-4-(4-propan-2-ylanilino)pyrrol-3-yl]sulfanylphenyl]-3-methylbutanamide |
| SMILES | COc1ccc(N2C(=O)C(Nc3ccc(C(C)C)cc3)=C(Sc3cccc(NC(=O)CC(C)C)c3)C2=O)cc1 |
| InChI | InChI=1S/C31H33N3O4S/c1-19(2)17-27(35)32-23-7-6-8-26(18-23)39-29-28(33-22-11-9-21(10-12-22)20(3)4)30(36)34(31(29)37)24-13-15-25(38-5)16-14-24/h6-16,18-20,33H,17H2,1-5H3,(H,32,35) |
| InChIKey | TYZXKJADGNKGQX-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.69 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|