C32H24F3N3O5S — CID 71957240
4-methoxy-N-[3-[4-(4-methoxyanilino)-2,5-dioxo-1-[4-(trifluoromethyl)phenyl]pyrrol-3-yl]sulfanylphenyl]benzamide (PubChem CID 71957240) has the molecular formula C32H24F3N3O5S and a molecular weight of 619.62 g/mol. Its IUPAC name is 4-methoxy-N-[3-[4-(4-methoxyanilino)-2,5-dioxo-1-[4-(trifluoromethyl)phenyl]pyrrol-3-yl]sulfanylphenyl]benzamide.
| Compound Name | 4-methoxy-N-[3-[4-(4-methoxyanilino)-2,5-dioxo-1-[4-(trifluoromethyl)phenyl]pyrrol-3-yl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 71957240 |
| Molecular Formula | C32H24F3N3O5S |
| Molecular Weight | 619.62 g/mol |
| Exact Mass | 619.14 |
| IUPAC Name | 4-methoxy-N-[3-[4-(4-methoxyanilino)-2,5-dioxo-1-[4-(trifluoromethyl)phenyl]pyrrol-3-yl]sulfanylphenyl]benzamide |
| SMILES | COc1ccc(NC2=C(Sc3cccc(NC(=O)c4ccc(OC)cc4)c3)C(=O)N(c3ccc(C(F)(F)F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C32H24F3N3O5S/c1-42-24-14-6-19(7-15-24)29(39)37-22-4-3-5-26(18-22)44-28-27(36-21-10-16-25(43-2)17-11-21)30(40)38(31(28)41)23-12-8-20(9-13-23)32(33,34)35/h3-18,36H,1-2H3,(H,37,39) |
| InChIKey | WNMISXNSUKJWKM-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.62 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|